C12H12N4 — CID 143186331
1-(1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 143186331) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-(1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 143186331 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CCNC2c1nccnn1 |
| InChI | InChI=1S/C12H12N4/c1-2-4-10-9(3-1)5-6-13-11(10)12-14-7-8-15-16-12/h1-4,7-8,11,13H,5-6H2 |
| InChIKey | BOESFGXVHCBUPH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |