C12H14N4 — CID 114687785
1-(3-methyltriazol-4-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 114687785) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-(3-methyltriazol-4-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(3-methyltriazol-4-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 114687785 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(3-methyltriazol-4-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cn1nncc1C1NCCc2ccccc21 |
| InChI | InChI=1S/C12H14N4/c1-16-11(8-14-15-16)12-10-5-3-2-4-9(10)6-7-13-12/h2-5,8,12-13H,6-7H2,1H3 |
| InChIKey | LYTANRAPEYDDRL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |