C18H16N2O6 — CID 174576912
bis(benzonitrile);2,3-dihydroxybutanedioic acid (PubChem CID 174576912) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is bis(benzonitrile);2,3-dihydroxybutanedioic acid.
| Compound Name | bis(benzonitrile);2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 174576912 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | bis(benzonitrile);2,3-dihydroxybutanedioic acid |
| SMILES | N#Cc1ccccc1.N#Cc1ccccc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/2C7H5N.C4H6O6/c2*8-6-7-4-2-1-3-5-7;5-1(3(7)8)2(6)4(9)10/h2*1-5H;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | UJYNTZCFCSGLPB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |