C10H14N2 — CID 70630452
4-phenyl-1,3-diazinane (PubChem CID 70630452) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 4-phenyl-1,3-diazinane.
| Compound Name | 4-phenyl-1,3-diazinane |
|---|---|
| PubChem CID | 70630452 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4-phenyl-1,3-diazinane |
| SMILES | c1ccc(C2CCNCN2)cc1 |
| InChI | InChI=1S/C10H14N2/c1-2-4-9(5-3-1)10-6-7-11-8-12-10/h1-5,10-12H,6-8H2 |
| InChIKey | MSVBZOAXZMFSLS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |