C29H32O5 — CID 11669788
(2R,4aR,6S,7R,8aS)-4a-methyl-2-phenyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine (PubChem CID 11669788) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8aS)-4a-methyl-2-phenyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7R,8aS)-4a-methyl-2-phenyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 11669788 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (2R,4aR,6S,7R,8aS)-4a-methyl-2-phenyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
| SMILES | C[C@@]12CO[C@@H](c3ccccc3)O[C@H]1C[C@@H](OCc1ccccc1)[C@H](COCc1ccccc1)O2 |
| InChI | InChI=1S/C29H32O5/c1-29-21-32-28(24-15-9-4-10-16-24)33-27(29)17-25(31-19-23-13-7-3-8-14-23)26(34-29)20-30-18-22-11-5-2-6-12-22/h2-16,25-28H,17-21H2,1H3/t25-,26+,27+,28-,29-/m1/s1 |
| InChIKey | GVYIZTSSXXIEGM-JYJZCUDQSA-N |
| XLogP | 5.45 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |