C36H52O8Si — CID 16720254
2-[(1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-13-phenylmethoxy-12-(phenylmethoxymethyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]acetic acid (PubChem CID 16720254) has the molecular formula C36H52O8Si and a molecular weight of 640.89 g/mol. Its IUPAC name is 2-[(1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-13-phenylmethoxy-12-(phenylmethoxymethyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]acetic acid.
| Compound Name | 2-[(1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-13-phenylmethoxy-12-(phenylmethoxymethyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]acetic acid |
|---|---|
| PubChem CID | 16720254 |
| Molecular Formula | C36H52O8Si |
| Molecular Weight | 640.89 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | 2-[(1R,3S,5R,6S,8R,10S,12R,13S)-5-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-13-phenylmethoxy-12-(phenylmethoxymethyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2O[C@@H]3C[C@H](OCc4ccccc4)[C@@H](COCc4ccccc4)O[C@@]3(C)C[C@@]2(C)O[C@H]1CC(=O)O |
| InChI | InChI=1S/C36H52O8Si/c1-34(2,3)45(6,7)44-29-19-32-35(4,42-28(29)20-33(37)38)24-36(5)31(41-32)18-27(40-22-26-16-12-9-13-17-26)30(43-36)23-39-21-25-14-10-8-11-15-25/h8-17,27-32H,18-24H2,1-7H3,(H,37,38)/t27-,28-,29+,30+,31+,32-,35+,36-/m0/s1 |
| InChIKey | HTBDJTSDVSXHMN-PLNQXNOHSA-N |
| XLogP | 6.91 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.89 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|