C17H21NO6 — CID 102083607
(1R,3S,4R,8S,10R)-4-hydroxy-4-(2-hydroxypropan-2-yl)-10-phenyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one (PubChem CID 102083607) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (1R,3S,4R,8S,10R)-4-hydroxy-4-(2-hydroxypropan-2-yl)-10-phenyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one.
| Compound Name | (1R,3S,4R,8S,10R)-4-hydroxy-4-(2-hydroxypropan-2-yl)-10-phenyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one |
|---|---|
| PubChem CID | 102083607 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (1R,3S,4R,8S,10R)-4-hydroxy-4-(2-hydroxypropan-2-yl)-10-phenyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one |
| SMILES | CC(C)(O)[C@]1(O)C(=O)N2C[C@@H]3O[C@H](c4ccccc4)OC[C@H]3O[C@H]21 |
| InChI | InChI=1S/C17H21NO6/c1-16(2,20)17(21)14(19)18-8-11-12(24-15(17)18)9-22-13(23-11)10-6-4-3-5-7-10/h3-7,11-13,15,20-21H,8-9H2,1-2H3/t11-,12+,13+,15-,17-/m0/s1 |
| InChIKey | MFJCWRKGFRUEKW-KAHWEZKRSA-N |
| XLogP | 0.17 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |