C11H13NO4S2 — CID 71092624
2-[3-(benzenesulfonyl)-1,3-thiazolidin-2-yl]acetic acid (PubChem CID 71092624) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-1,3-thiazolidin-2-yl]acetic acid.
| Compound Name | 2-[3-(benzenesulfonyl)-1,3-thiazolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 71092624 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-1,3-thiazolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1SCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO4S2/c13-11(14)8-10-12(6-7-17-10)18(15,16)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,14) |
| InChIKey | GYOXRSRJMNDCLO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |