C22H22O4S2 — CID 124525614
(1R,5R,6S,9S,10R)-9,10-bis(benzenesulfonyl)tricyclo[4.2.2.01,5]dec-7-ene (PubChem CID 124525614) has the molecular formula C22H22O4S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (1R,5R,6S,9S,10R)-9,10-bis(benzenesulfonyl)tricyclo[4.2.2.01,5]dec-7-ene.
| Compound Name | (1R,5R,6S,9S,10R)-9,10-bis(benzenesulfonyl)tricyclo[4.2.2.01,5]dec-7-ene |
|---|---|
| PubChem CID | 124525614 |
| Molecular Formula | C22H22O4S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (1R,5R,6S,9S,10R)-9,10-bis(benzenesulfonyl)tricyclo[4.2.2.01,5]dec-7-ene |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1[C@H]2C=C[C@@]3(CCC[C@H]23)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O4S2/c23-27(24,16-8-3-1-4-9-16)20-18-13-15-22(14-7-12-19(18)22)21(20)28(25,26)17-10-5-2-6-11-17/h1-6,8-11,13,15,18-21H,7,12,14H2/t18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | NCEPVJVJJQQOIF-ZSYZGHEHSA-N |
| XLogP | 3.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|