C28H26O4S2 — CID 15091933
CID 15091933 (PubChem CID 15091933) has the molecular formula C28H26O4S2 and a molecular weight of 490.65 g/mol.
| Compound Name | CID 15091933 |
|---|---|
| PubChem CID | 15091933 |
| Molecular Formula | C28H26O4S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | — |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1[C@H](S(=O)(=O)c2ccccc2)[C@H]2C3=C([C@@H]4C=C[C@H]3C43CC3)[C@@H]1C21CC1 |
| InChI | InChI=1S/C28H26O4S2/c29-33(30,17-7-3-1-4-8-17)25-23-21-19-11-12-20(27(19)13-14-27)22(21)24(28(23)15-16-28)26(25)34(31,32)18-9-5-2-6-10-18/h1-12,19-20,23-26H,13-16H2/t19-,20+,23-,24+,25-,26+ |
| InChIKey | ISRPQTGGVIYWGU-KELBCLRESA-N |
| XLogP | 4.60 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|