C13H11NO3S — CID 10869044
(1R,2R,3S,4S)-3-(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile (PubChem CID 10869044) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile.
| Compound Name | (1R,2R,3S,4S)-3-(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 10869044 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (1R,2R,3S,4S)-3-(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile |
| SMILES | N#C[C@H]1[C@H](S(=O)(=O)c2ccccc2)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C13H11NO3S/c14-8-10-11-6-7-12(17-11)13(10)18(15,16)9-4-2-1-3-5-9/h1-7,10-13H/t10-,11-,12+,13+/m1/s1 |
| InChIKey | GTOCVLOWOAYXBR-NDBYEHHHSA-N |
| XLogP | 1.31 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|