C15H17NO4S — CID 86729363
7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane-8-carbonitrile (PubChem CID 86729363) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane-8-carbonitrile.
| Compound Name | 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane-8-carbonitrile |
|---|---|
| PubChem CID | 86729363 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane-8-carbonitrile |
| SMILES | N#CC1CCC2(CC1S(=O)(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C15H17NO4S/c16-11-12-6-7-15(19-8-9-20-15)10-14(12)21(17,18)13-4-2-1-3-5-13/h1-5,12,14H,6-10H2 |
| InChIKey | OIGCXFCAEQOBJO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |