C13H13NO3S — CID 11139961
cis-(1R,2S)-2-(benzenesulfonyl)-5-oxocyclohexane-1-carbonitrile (PubChem CID 11139961) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is cis-(1R,2S)-2-(benzenesulfonyl)-5-oxocyclohexane-1-carbonitrile.
| Compound Name | cis-(1R,2S)-2-(benzenesulfonyl)-5-oxocyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 11139961 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | cis-(1R,2S)-2-(benzenesulfonyl)-5-oxocyclohexane-1-carbonitrile |
| SMILES | N#C[C@H]1CC(=O)CC[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO3S/c14-9-10-8-11(15)6-7-13(10)18(16,17)12-4-2-1-3-5-12/h1-5,10,13H,6-8H2/t10-,13+/m1/s1 |
| InChIKey | QEJNXHKOIFRKNU-MFKMUULPSA-N |
| XLogP | 1.72 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |