C21H32O6SSi — CID 154447210
[(3aR,4R,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-methylbenzenesulfonate (PubChem CID 154447210) has the molecular formula C21H32O6SSi and a molecular weight of 440.63 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154447210 |
| Molecular Formula | C21H32O6SSi |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@@H]3OC(=O)C[C@@H]3[C@@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32O6SSi/c1-14-7-9-15(10-8-14)28(23,24)27-19-12-18-16(11-20(22)26-18)17(19)13-25-29(5,6)21(2,3)4/h7-10,16-19H,11-13H2,1-6H3/t16-,17+,18+,19-/m1/s1 |
| InChIKey | DKAIGRACZWPOPA-YDZRNGNQSA-N |
| XLogP | 4.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|