C24H40O5 — CID 57299786
trans-(2R,3R)-3-(4,9-dihydroxy-5,5-dimethylnon-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one (PubChem CID 57299786) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4,9-dihydroxy-5,5-dimethylnon-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-(4,9-dihydroxy-5,5-dimethylnon-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 57299786 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | trans-(2R,3R)-3-(4,9-dihydroxy-5,5-dimethylnon-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one |
| SMILES | CC(C)(CCCCO)C(O)CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC(=O)CO |
| InChI | InChI=1S/C24H40O5/c1-24(2,16-7-8-17-25)23(29)13-9-10-19-14-15-22(28)21(19)12-6-4-3-5-11-20(27)18-26/h4,6,9-10,19,21,23,25-26,29H,3,5,7-8,11-18H2,1-2H3/t19-,21+,23?/m0/s1 |
| InChIKey | QOEWWILGJKIELT-ZPVUCFGCSA-N |
| XLogP | 3.76 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|