C22H36O6 — CID 56995028
2-hydroxy-7-[(1R,2R)-2-(3-hydroxy-4,4-dimethyl-5-propan-2-yloxypent-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 56995028) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R,2R)-2-(3-hydroxy-4,4-dimethyl-5-propan-2-yloxypent-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 2-hydroxy-7-[(1R,2R)-2-(3-hydroxy-4,4-dimethyl-5-propan-2-yloxypent-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56995028 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-hydroxy-7-[(1R,2R)-2-(3-hydroxy-4,4-dimethyl-5-propan-2-yloxypent-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)OCC(C)(C)C(O)C=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O |
| InChI | InChI=1S/C22H36O6/c1-15(2)28-14-22(3,4)20(25)13-11-16-10-12-18(23)17(16)8-6-5-7-9-19(24)21(26)27/h5-6,11,13,15-17,19-20,24-25H,7-10,12,14H2,1-4H3,(H,26,27)/t16-,17-,19?,20?/m1/s1 |
| InChIKey | XJFOYHRALCUEAU-NXMBOHNASA-N |
| XLogP | 3.12 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|