C41H52O4 — CID 70637099
ethyl 7-[(5S)-2-oxo-5-(4-trityloxyoctyl)cyclopentyl]hept-2-enoate (PubChem CID 70637099) has the molecular formula C41H52O4 and a molecular weight of 608.86 g/mol. Its IUPAC name is ethyl 7-[(5S)-2-oxo-5-(4-trityloxyoctyl)cyclopentyl]hept-2-enoate.
| Compound Name | ethyl 7-[(5S)-2-oxo-5-(4-trityloxyoctyl)cyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 70637099 |
| Molecular Formula | C41H52O4 |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | ethyl 7-[(5S)-2-oxo-5-(4-trityloxyoctyl)cyclopentyl]hept-2-enoate |
| SMILES | CCCCC(CCC[C@H]1CCC(=O)C1CCCCC=CC(=O)OCC)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H52O4/c1-3-5-27-37(28-19-20-33-31-32-39(42)38(33)29-17-6-7-18-30-40(43)44-4-2)45-41(34-21-11-8-12-22-34,35-23-13-9-14-24-35)36-25-15-10-16-26-36/h8-16,18,21-26,30,33,37-38H,3-7,17,19-20,27-29,31-32H2,1-2H3/t33-,37?,38?/m0/s1 |
| InChIKey | PTNQOLSBTFWKJO-RJZGSXQISA-N |
| XLogP | 10.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|