C23H40O5 — CID 70636825
ethyl 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-5-methyloctyl)-5-oxocyclopentyl]hept-2-enoate (PubChem CID 70636825) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is ethyl 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-5-methyloctyl)-5-oxocyclopentyl]hept-2-enoate.
| Compound Name | ethyl 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-5-methyloctyl)-5-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 70636825 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | ethyl 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-5-methyloctyl)-5-oxocyclopentyl]hept-2-enoate |
| SMILES | CCCC(C)C(O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCC=CC(=O)OCC |
| InChI | InChI=1S/C23H40O5/c1-4-11-17(3)20(24)14-10-13-19-18(21(25)16-22(19)26)12-8-6-7-9-15-23(27)28-5-2/h9,15,17-20,22,24,26H,4-8,10-14,16H2,1-3H3/t17?,18-,19-,20?,22-/m1/s1 |
| InChIKey | CDLFIWLSZUAVHE-SPFHDNFTSA-N |
| XLogP | 4.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|