C36H50N2O5 — CID 57237212
[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoctyl]-5-oxocyclopentyl]hept-2-enoate (PubChem CID 57237212) has the molecular formula C36H50N2O5 and a molecular weight of 590.81 g/mol. Its IUPAC name is [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoctyl]-5-oxocyclopentyl]hept-2-enoate.
| Compound Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoctyl]-5-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57237212 |
| Molecular Formula | C36H50N2O5 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoctyl]-5-oxocyclopentyl]hept-2-enoate |
| SMILES | CCCCC[C@H](O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCC=CC(=O)OC[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C36H50N2O5/c1-3-4-7-11-26(39)16-17-28-27(33(40)20-34(28)41)12-8-5-6-9-15-35(42)43-23-24-18-30-29-13-10-14-31-36(29)25(21-37-31)19-32(30)38(2)22-24/h9-10,13-15,18,21,24,26-28,32,34,37,39,41H,3-8,11-12,16-17,19-20,22-23H2,1-2H3/t24-,26+,27-,28-,32-,34-/m1/s1 |
| InChIKey | CDVUAMUWBARYTR-QWGADCQOSA-N |
| XLogP | 5.98 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|