C30H48O3P+ — CID 134942776
tributyl-[(8E)-10-ethoxy-3-hydroxy-10-oxo-1-phenyldeca-1,2,8-trienyl]phosphanium (PubChem CID 134942776) has the molecular formula C30H48O3P+ and a molecular weight of 487.69 g/mol. Its IUPAC name is tributyl-[(8E)-10-ethoxy-3-hydroxy-10-oxo-1-phenyldeca-1,2,8-trienyl]phosphanium.
| Compound Name | tributyl-[(8E)-10-ethoxy-3-hydroxy-10-oxo-1-phenyldeca-1,2,8-trienyl]phosphanium |
|---|---|
| PubChem CID | 134942776 |
| Molecular Formula | C30H48O3P+ |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | tributyl-[(8E)-10-ethoxy-3-hydroxy-10-oxo-1-phenyldeca-1,2,8-trienyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)C(=C=C(O)CCCC/C=C/C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C30H47O3P/c1-5-9-23-34(24-10-6-2,25-11-7-3)29(27-19-15-14-16-20-27)26-28(31)21-17-12-13-18-22-30(32)33-8-4/h14-16,18-20,22H,5-13,17,21,23-25H2,1-4H3/p+1/b22-18+ |
| InChIKey | VKYZJVAWUUSWLW-RELWKKBWSA-O |
| XLogP | 9.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|