C48H82O7 — CID 57321006
[1-butoxy-3-ethoxy-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-1-oxohept-2-en-2-yl] 2-ethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]hept-2-enoate (PubChem CID 57321006) has the molecular formula C48H82O7 and a molecular weight of 771.18 g/mol. Its IUPAC name is [1-butoxy-3-ethoxy-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-1-oxohept-2-en-2-yl] 2-ethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]hept-2-enoate.
| Compound Name | [1-butoxy-3-ethoxy-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-1-oxohept-2-en-2-yl] 2-ethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57321006 |
| Molecular Formula | C48H82O7 |
| Molecular Weight | 771.18 g/mol |
| Exact Mass | 770.61 |
| IUPAC Name | [1-butoxy-3-ethoxy-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-1-oxohept-2-en-2-yl] 2-ethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]hept-2-enoate |
| SMILES | CCCCCCCC[C@H]1CCC(=O)[C@@H]1CCCCC=C(CC)C(=O)OC(C(=O)OCCCC)=C(CCCC[C@H]1C(=O)CC[C@@H]1CCCCCCCC)OCC |
| InChI | InChI=1S/C48H82O7/c1-6-11-14-16-18-21-28-39-33-35-43(49)41(39)30-24-20-23-27-38(9-4)47(51)55-46(48(52)54-37-13-8-3)45(53-10-5)32-26-25-31-42-40(34-36-44(42)50)29-22-19-17-15-12-7-2/h27,39-42H,6-26,28-37H2,1-5H3/t39-,40-,41+,42+/m0/s1 |
| InChIKey | CWSAGCCYFOAIJM-ATUXXYJQSA-N |
| XLogP | 13.27 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.18 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|