C22H40O4 — CID 18595037
7-[(1R,2S)-2-(3-hydroxy-6,7-dimethyloctyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 18595037) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is 7-[(1R,2S)-2-(3-hydroxy-6,7-dimethyloctyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S)-2-(3-hydroxy-6,7-dimethyloctyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18595037 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 7-[(1R,2S)-2-(3-hydroxy-6,7-dimethyloctyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(C)C(C)CCC(O)CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H40O4/c1-16(2)17(3)10-13-19(23)14-11-18-12-15-21(24)20(18)8-6-4-5-7-9-22(25)26/h16-20,23H,4-15H2,1-3H3,(H,25,26)/t17?,18-,19?,20+/m0/s1 |
| InChIKey | WVQZRBPYWFCIRD-ZUPWUQBJSA-N |
| XLogP | 5.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|