C24H38O7 — CID 57311651
ethyl 8-[(1R,2R)-2-[(4R)-4-formyloct-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooctanoate (PubChem CID 57311651) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is ethyl 8-[(1R,2R)-2-[(4R)-4-formyloct-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooctanoate.
| Compound Name | ethyl 8-[(1R,2R)-2-[(4R)-4-formyloct-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooctanoate |
|---|---|
| PubChem CID | 57311651 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl 8-[(1R,2R)-2-[(4R)-4-formyloct-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooctanoate |
| SMILES | CCCC[C@@H](C=O)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(O)C(=O)C(=O)OCC |
| InChI | InChI=1S/C24H38O7/c1-3-5-10-18(17-25)11-9-12-19-14-15-21(26)20(19)13-7-6-8-16-24(29,30)22(27)23(28)31-4-2/h9,12,17-20,29-30H,3-8,10-11,13-16H2,1-2H3/t18-,19+,20-/m1/s1 |
| InChIKey | JUQJRNKFCMIUDW-HSALFYBXSA-N |
| XLogP | 3.30 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|