C23H35ClO6 — CID 54497648
ethyl 8-[(1R,2R)-2-[(4R)-7-chloro-4-methylhept-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooct-6-enoate (PubChem CID 54497648) has the molecular formula C23H35ClO6 and a molecular weight of 442.98 g/mol. Its IUPAC name is ethyl 8-[(1R,2R)-2-[(4R)-7-chloro-4-methylhept-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooct-6-enoate.
| Compound Name | ethyl 8-[(1R,2R)-2-[(4R)-7-chloro-4-methylhept-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooct-6-enoate |
|---|---|
| PubChem CID | 54497648 |
| Molecular Formula | C23H35ClO6 |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethyl 8-[(1R,2R)-2-[(4R)-7-chloro-4-methylhept-1-enyl]-5-oxocyclopentyl]-3,3-dihydroxy-2-oxooct-6-enoate |
| SMILES | CCOC(=O)C(=O)C(O)(O)CCC=CC[C@H]1C(=O)CC[C@@H]1C=CC[C@H](C)CCCCl |
| InChI | InChI=1S/C23H35ClO6/c1-3-30-22(27)21(26)23(28,29)15-6-4-5-12-19-18(13-14-20(19)25)11-7-9-17(2)10-8-16-24/h4-5,7,11,17-19,28-29H,3,6,8-10,12-16H2,1-2H3/t17-,18-,19+/m0/s1 |
| InChIKey | YAGCOWQTVYFHOM-GBESFXJTSA-N |
| XLogP | 3.72 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|