C23H38O5 — CID 54151220
2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[4-(1-propylcyclobutyl)but-1-enyl]cyclopentyl]heptanoic acid (PubChem CID 54151220) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[4-(1-propylcyclobutyl)but-1-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[4-(1-propylcyclobutyl)but-1-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54151220 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[4-(1-propylcyclobutyl)but-1-enyl]cyclopentyl]heptanoic acid |
| SMILES | CCCC1(CCC=C[C@H]2CCC(=O)[C@@H]2CCCCCC(O)(O)C(=O)O)CCC1 |
| InChI | InChI=1S/C23H38O5/c1-2-13-22(15-8-16-22)14-7-5-9-18-11-12-20(24)19(18)10-4-3-6-17-23(27,28)21(25)26/h5,9,18-19,27-28H,2-4,6-8,10-17H2,1H3,(H,25,26)/t18-,19+/m0/s1 |
| InChIKey | OHWMHVHLGJMQOG-RBUKOAKNSA-N |
| XLogP | 4.60 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|