C20H32O4 — CID 173439856
trans-(2R,3R)-2-(6,7-dihydroxy-5-oxohept-6-enyl)-3-[(E)-oct-1-enyl]cyclopentan-1-one (PubChem CID 173439856) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is trans-(2R,3R)-2-(6,7-dihydroxy-5-oxohept-6-enyl)-3-[(E)-oct-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-(6,7-dihydroxy-5-oxohept-6-enyl)-3-[(E)-oct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 173439856 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | trans-(2R,3R)-2-(6,7-dihydroxy-5-oxohept-6-enyl)-3-[(E)-oct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCCC(=O)C(O)=CO |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-7-10-16-13-14-18(22)17(16)11-8-9-12-19(23)20(24)15-21/h7,10,15-17,21,24H,2-6,8-9,11-14H2,1H3/b10-7+,20-15?/t16-,17+/m0/s1 |
| InChIKey | LAFWSFWGIIRTGC-JLPYDSIKSA-N |
| XLogP | 5.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|