C24H34FNO6 — CID 22970249
ethyl (E)-7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoate (PubChem CID 22970249) has the molecular formula C24H34FNO6 and a molecular weight of 451.54 g/mol. Its IUPAC name is ethyl (E)-7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoate.
| Compound Name | ethyl (E)-7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 22970249 |
| Molecular Formula | C24H34FNO6 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | ethyl (E)-7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]hept-5-enoate |
| SMILES | CCOC(=O)CCC/C=C/CC1C(O)C/C(=N/O)C1CCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C24H34FNO6/c1-2-31-24(29)8-6-4-3-5-7-21-20(22(26-30)15-23(21)28)14-11-18(27)16-32-19-12-9-17(25)10-13-19/h3,5,9-10,12-13,18,20-21,23,27-28,30H,2,4,6-8,11,14-16H2,1H3/b5-3+,26-22- |
| InChIKey | HIKYEFNFBZYJIN-DWPYMBNRSA-N |
| XLogP | 3.85 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|