C22H31F2NO6 — CID 22970228
7-[(3Z)-2-[4-(2,4-difluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid (PubChem CID 22970228) has the molecular formula C22H31F2NO6 and a molecular weight of 443.49 g/mol. Its IUPAC name is 7-[(3Z)-2-[4-(2,4-difluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(3Z)-2-[4-(2,4-difluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22970228 |
| Molecular Formula | C22H31F2NO6 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 7-[(3Z)-2-[4-(2,4-difluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)C/C(=N/O)C1CCC(O)COc1ccc(F)cc1F |
| InChI | InChI=1S/C22H31F2NO6/c23-14-7-10-21(18(24)11-14)31-13-15(26)8-9-16-17(20(27)12-19(16)25-30)5-3-1-2-4-6-22(28)29/h7,10-11,15-17,20,26-27,30H,1-6,8-9,12-13H2,(H,28,29)/b25-19- |
| InChIKey | FSKUTIUJCWLLKH-PLRJNAJWSA-N |
| XLogP | 3.74 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|