C23H37NO5S — CID 58654664
methyl 7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(3S)-3-hydroxy-6-thiophen-2-ylhexyl]cyclopentyl]heptanoate (PubChem CID 58654664) has the molecular formula C23H37NO5S and a molecular weight of 439.62 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(3S)-3-hydroxy-6-thiophen-2-ylhexyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(3S)-3-hydroxy-6-thiophen-2-ylhexyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 58654664 |
| Molecular Formula | C23H37NO5S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | methyl 7-[(1R,2R,3Z,5S)-5-hydroxy-3-hydroxyimino-2-[(3S)-3-hydroxy-6-thiophen-2-ylhexyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](O)C/C(=N/O)[C@@H]1CC[C@@H](O)CCCc1cccs1 |
| InChI | InChI=1S/C23H37NO5S/c1-29-23(27)12-5-3-2-4-11-20-19(21(24-28)16-22(20)26)14-13-17(25)8-6-9-18-10-7-15-30-18/h7,10,15,17,19-20,22,25-26,28H,2-6,8-9,11-14,16H2,1H3/b24-21-/t17-,19+,20+,22-/m0/s1 |
| InChIKey | PUCUTMBYYJHKBQ-FHDRCWDFSA-N |
| XLogP | 4.55 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|