C25H37F3O5 — CID 162577257
methyl 7-[(3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-[2-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate (PubChem CID 162577257) has the molecular formula C25H37F3O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is methyl 7-[(3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-[2-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-[2-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 162577257 |
| Molecular Formula | C25H37F3O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | methyl 7-[(3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-[2-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(CC[C@@H](O)CCc2ccccc2C(F)(F)F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H37F3O5/c1-33-24(32)11-5-3-2-4-9-19-20(23(31)16-22(19)30)15-14-18(29)13-12-17-8-6-7-10-21(17)25(26,27)28/h6-8,10,18-20,22-23,29-31H,2-5,9,11-16H2,1H3/t18-,19?,20?,22-,23+/m0/s1 |
| InChIKey | ODHFPYOANIXDST-ZCEZJHDXSA-N |
| XLogP | 4.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|