C27H44O6 — CID 58090945
10-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-1-hydroxy-2-(hydroxymethyl)decan-4-one (PubChem CID 58090945) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is 10-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-1-hydroxy-2-(hydroxymethyl)decan-4-one.
| Compound Name | 10-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-1-hydroxy-2-(hydroxymethyl)decan-4-one |
|---|---|
| PubChem CID | 58090945 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 10-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-1-hydroxy-2-(hydroxymethyl)decan-4-one |
| SMILES | O=C(CCCCCC[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)CC(CO)CO |
| InChI | InChI=1S/C27H44O6/c28-18-21(19-29)16-23(31)10-6-1-2-7-11-24-25(27(33)17-26(24)32)15-14-22(30)13-12-20-8-4-3-5-9-20/h3-5,8-9,21-22,24-30,32-33H,1-2,6-7,10-19H2/t22-,24+,25+,26-,27+/m0/s1 |
| InChIKey | GFRGUKHPNSTHLW-GWDFDJHTSA-N |
| XLogP | 3.02 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|