C22H29FO7 — CID 54199813
methyl 7-[(1R,2R,3R)-2-[3-(4-fluorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 54199813) has the molecular formula C22H29FO7 and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[3-(4-fluorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[3-(4-fluorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54199813 |
| Molecular Formula | C22H29FO7 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[3-(4-fluorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1OCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H29FO7/c1-28-21(27)7-5-3-2-4-6-18-19(25)12-20(26)22(18)30-14-16(24)13-29-17-10-8-15(23)9-11-17/h2,4,8-11,16,18,20,22,24,26H,3,5-7,12-14H2,1H3/t16?,18-,20+,22+/m0/s1 |
| InChIKey | POKTWBSERYCTTJ-HXJOSRERSA-N |
| XLogP | 2.19 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|