C21H27ClO7 — CID 70389967
(E)-7-[2-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70389967) has the molecular formula C21H27ClO7 and a molecular weight of 426.89 g/mol. Its IUPAC name is (E)-7-[2-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389967 |
| Molecular Formula | C21H27ClO7 |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (E)-7-[2-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C(=O)CC(O)C1OCC(O)COc1ccccc1Cl |
| InChI | InChI=1S/C21H27ClO7/c22-16-8-5-6-9-19(16)28-12-14(23)13-29-21-15(17(24)11-18(21)25)7-3-1-2-4-10-20(26)27/h1,3,5-6,8-9,14-15,18,21,23,25H,2,4,7,10-13H2,(H,26,27)/b3-1+ |
| InChIKey | JGTLDSHQOSNPCE-HNQUOIGGSA-N |
| XLogP | 2.62 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|