C19H24O5 — CID 67527571
7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoic acid (PubChem CID 67527571) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67527571 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C19H24O5/c20-17-12-18(21)16(13-24-14-8-4-3-5-9-14)15(17)10-6-1-2-7-11-19(22)23/h1,3-6,8-9,15-16,18,21H,2,7,10-13H2,(H,22,23)/t15-,16-,18-/m1/s1 |
| InChIKey | FSRXFOSYBKJVBK-JFIYKMOQSA-N |
| XLogP | 2.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|