C19H22O4 — CID 11631047
(Z)-7-[(1R,5S)-2-oxo-5-(phenoxymethyl)cyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 11631047) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (Z)-7-[(1R,5S)-2-oxo-5-(phenoxymethyl)cyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,5S)-2-oxo-5-(phenoxymethyl)cyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11631047 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (Z)-7-[(1R,5S)-2-oxo-5-(phenoxymethyl)cyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)C=C[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C19H22O4/c20-18-13-12-15(14-23-16-8-4-3-5-9-16)17(18)10-6-1-2-7-11-19(21)22/h1,3-6,8-9,12-13,15,17H,2,7,10-11,14H2,(H,21,22)/b6-1-/t15-,17-/m1/s1 |
| InChIKey | VNNQYBQKXWSJQJ-NIAJTGCUSA-N |
| XLogP | 3.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|