C27H42FNO4 — CID 172958818
7-[(3Z)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3-[(2-methylpropan-2-yl)oxyimino]cyclopentyl]heptanoic acid (PubChem CID 172958818) has the molecular formula C27H42FNO4 and a molecular weight of 463.63 g/mol. Its IUPAC name is 7-[(3Z)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3-[(2-methylpropan-2-yl)oxyimino]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(3Z)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3-[(2-methylpropan-2-yl)oxyimino]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 172958818 |
| Molecular Formula | C27H42FNO4 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 7-[(3Z)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3-[(2-methylpropan-2-yl)oxyimino]cyclopentyl]heptanoic acid |
| SMILES | CC(C)(C)O/N=C1/CCC(CCCCCCC(=O)O)C1CC[C@@H](O)CCc1cccc(F)c1 |
| InChI | InChI=1S/C27H42FNO4/c1-27(2,3)33-29-25-18-14-21(10-6-4-5-7-12-26(31)32)24(25)17-16-23(30)15-13-20-9-8-11-22(28)19-20/h8-9,11,19,21,23-24,30H,4-7,10,12-18H2,1-3H3,(H,31,32)/b29-25-/t21?,23-,24?/m0/s1 |
| InChIKey | VLMAKNXCTMPYMZ-NZWNNPQTSA-N |
| XLogP | 6.52 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|