C23H34O2S — CID 144709534
2-(3-cyclopentylpropyl)-1-benzothiophene;heptanoic acid (PubChem CID 144709534) has the molecular formula C23H34O2S and a molecular weight of 374.59 g/mol. Its IUPAC name is 2-(3-cyclopentylpropyl)-1-benzothiophene;heptanoic acid.
| Compound Name | 2-(3-cyclopentylpropyl)-1-benzothiophene;heptanoic acid |
|---|---|
| PubChem CID | 144709534 |
| Molecular Formula | C23H34O2S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-(3-cyclopentylpropyl)-1-benzothiophene;heptanoic acid |
| SMILES | CCCCCCC(=O)O.c1ccc2sc(CCCC3CCCC3)cc2c1 |
| InChI | InChI=1S/C16H20S.C7H14O2/c1-2-7-13(6-1)8-5-10-15-12-14-9-3-4-11-16(14)17-15;1-2-3-4-5-6-7(8)9/h3-4,9,11-13H,1-2,5-8,10H2;2-6H2,1H3,(H,8,9) |
| InChIKey | VASGNNLUJMNOAP-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|