About 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate
2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate (PubChem CID 144709503) has the molecular formula C25H40O3S
and a molecular weight of 420.66 g/mol. Its IUPAC name is 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate.
Molecular Properties
| Compound Name | 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate |
| PubChem CID | 144709503 |
| Molecular Formula | C25H40O3S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate |
| SMILES | CCCCCCC(=O)OC.CO.c1ccc2sc(CCCC3CCCC3)cc2c1 |
| InChI | InChI=1S/C16H20S.C8H16O2.CH4O/c1-2-7-13(6-1)8-5-10-15-12-14-9-3-4-11-16(14)17-15;1-3-4-5-6-7-8(9)10-2;1-2/h3-4,9,11-13H,1-2,5-8,10H2;3-7H2,1-2H3;2H,1H3 |
| InChIKey | QRWBIDBINPQSOT-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate?
The IUPAC name of 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate (CID 144709503) is 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate.
What is the SMILES notation for 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate?
The canonical SMILES for 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate is CCCCCCC(=O)OC.CO.c1ccc2sc(CCCC3CCCC3)cc2c1.
What is the InChIKey of 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate?
The InChIKey is QRWBIDBINPQSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20S.C8H16O2.CH4O/c1-2-7-13(6-1)8-5-10-15-12-14-9-3-4-11-16(14)17-15;1-3-4-5-6-7-8(9)10-2;1-2/h3-4,9,11-13H,1-2,5-8,10H2;3-7H2,1-2H3;2H,1H3.
What are the key properties of 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate?
2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate has a molecular weight of 420.66 g/mol, XLogP of 7.15, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopentylpropyl)-1-benzothiophene;methanol;methyl heptanoate is sourced from PubChem (CID 144709503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).