C23H34OS — CID 134386792
(1S,2R,3S)-3-[3-(1-benzothiophen-2-yl)propyl]-2-heptylcyclopentan-1-ol (PubChem CID 134386792) has the molecular formula C23H34OS and a molecular weight of 358.59 g/mol. Its IUPAC name is (1S,2R,3S)-3-[3-(1-benzothiophen-2-yl)propyl]-2-heptylcyclopentan-1-ol.
| Compound Name | (1S,2R,3S)-3-[3-(1-benzothiophen-2-yl)propyl]-2-heptylcyclopentan-1-ol |
|---|---|
| PubChem CID | 134386792 |
| Molecular Formula | C23H34OS |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (1S,2R,3S)-3-[3-(1-benzothiophen-2-yl)propyl]-2-heptylcyclopentan-1-ol |
| SMILES | CCCCCCC[C@@H]1[C@@H](CCCc2cc3ccccc3s2)CC[C@@H]1O |
| InChI | InChI=1S/C23H34OS/c1-2-3-4-5-6-13-21-18(15-16-22(21)24)11-9-12-20-17-19-10-7-8-14-23(19)25-20/h7-8,10,14,17-18,21-22,24H,2-6,9,11-13,15-16H2,1H3/t18-,21+,22-/m0/s1 |
| InChIKey | ONEILUPCTHFDQT-BWAGFHJFSA-N |
| XLogP | 6.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|