About ethane;octylcyclopentane;6-oxohexanoic acid
ethane;octylcyclopentane;6-oxohexanoic acid (PubChem CID 142072660) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is ethane;octylcyclopentane;6-oxohexanoic acid.
Molecular Properties
| Compound Name | ethane;octylcyclopentane;6-oxohexanoic acid |
| PubChem CID | 142072660 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | ethane;octylcyclopentane;6-oxohexanoic acid |
| SMILES | CC.CCCCCCCCC1CCCC1.O=CCCCCC(=O)O |
| InChI | InChI=1S/C13H26.C6H10O3.C2H6/c1-2-3-4-5-6-7-10-13-11-8-9-12-13;7-5-3-1-2-4-6(8)9;1-2/h13H,2-12H2,1H3;5H,1-4H2,(H,8,9);1-2H3 |
| InChIKey | VLFSKATUMKGRHR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;octylcyclopentane;6-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;octylcyclopentane;6-oxohexanoic acid?
The IUPAC name of ethane;octylcyclopentane;6-oxohexanoic acid (CID 142072660) is ethane;octylcyclopentane;6-oxohexanoic acid.
What is the SMILES notation for ethane;octylcyclopentane;6-oxohexanoic acid?
The canonical SMILES for ethane;octylcyclopentane;6-oxohexanoic acid is CC.CCCCCCCCC1CCCC1.O=CCCCCC(=O)O.
What is the InChIKey of ethane;octylcyclopentane;6-oxohexanoic acid?
The InChIKey is VLFSKATUMKGRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26.C6H10O3.C2H6/c1-2-3-4-5-6-7-10-13-11-8-9-12-13;7-5-3-1-2-4-6(8)9;1-2/h13H,2-12H2,1H3;5H,1-4H2,(H,8,9);1-2H3.
What are the key properties of ethane;octylcyclopentane;6-oxohexanoic acid?
ethane;octylcyclopentane;6-oxohexanoic acid has a molecular weight of 342.56 g/mol, XLogP of 6.78, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;octylcyclopentane;6-oxohexanoic acid is sourced from PubChem (CID 142072660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).