C37H50F2O4Si — CID 90716312
methyl 7-[(1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(3,3-difluorooctylidene)-3-oxocyclopentyl]hept-5-enoate (PubChem CID 90716312) has the molecular formula C37H50F2O4Si and a molecular weight of 624.88 g/mol. Its IUPAC name is methyl 7-[(1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(3,3-difluorooctylidene)-3-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(3,3-difluorooctylidene)-3-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90716312 |
| Molecular Formula | C37H50F2O4Si |
| Molecular Weight | 624.88 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | methyl 7-[(1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(3,3-difluorooctylidene)-3-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(F)(F)CC=C1C(=O)C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C37H50F2O4Si/c1-6-7-18-26-37(38,39)27-25-31-32(23-16-8-9-17-24-35(41)42-5)34(28-33(31)40)43-44(36(2,3)4,29-19-12-10-13-20-29)30-21-14-11-15-22-30/h8,10-16,19-22,25,32,34H,6-7,9,17-18,23-24,26-28H2,1-5H3/t32-,34+/m1/s1 |
| InChIKey | UZGUDFVGJPHHIN-CWTKIQHKSA-N |
| XLogP | 8.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.88 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|