C31H42O5Si — CID 71613528
[(1S,2R,3S,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-ethoxyethoxy)-2-prop-2-ynylcyclopentyl] acetate (PubChem CID 71613528) has the molecular formula C31H42O5Si and a molecular weight of 522.76 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-ethoxyethoxy)-2-prop-2-ynylcyclopentyl] acetate.
| Compound Name | [(1S,2R,3S,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-ethoxyethoxy)-2-prop-2-ynylcyclopentyl] acetate |
|---|---|
| PubChem CID | 71613528 |
| Molecular Formula | C31H42O5Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | [(1S,2R,3S,4R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-ethoxyethoxy)-2-prop-2-ynylcyclopentyl] acetate |
| SMILES | C#CC[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OCCOCC)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H42O5Si/c1-7-15-27-28(29(34-21-20-33-8-2)22-30(27)36-24(3)32)23-35-37(31(4,5)6,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h1,9-14,16-19,27-30H,8,15,20-23H2,2-6H3/t27-,28-,29-,30+/m1/s1 |
| InChIKey | NZELQZNQMBLMDZ-CSBHBGLHSA-N |
| XLogP | 4.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|