C33H42O4Si — CID 11800366
[(1R,2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-phenylmethoxyethyl)cyclopentyl] acetate (PubChem CID 11800366) has the molecular formula C33H42O4Si and a molecular weight of 530.78 g/mol. Its IUPAC name is [(1R,2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-phenylmethoxyethyl)cyclopentyl] acetate.
| Compound Name | [(1R,2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-phenylmethoxyethyl)cyclopentyl] acetate |
|---|---|
| PubChem CID | 11800366 |
| Molecular Formula | C33H42O4Si |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | [(1R,2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-phenylmethoxyethyl)cyclopentyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C33H42O4Si/c1-26(34)37-32-21-20-28(31(32)22-23-35-24-27-14-8-5-9-15-27)25-36-38(33(2,3)4,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-19,28,31-32H,20-25H2,1-4H3/t28-,31-,32+/m0/s1 |
| InChIKey | CEWNFLGMAXFJHJ-JWBZKWLISA-N |
| XLogP | 6.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|