C40H52O7Si — CID 100997760
[(2R,3S,5S,7S,8S,9R)-7-[tert-butyl(diphenyl)silyl]oxy-4,4,8-trimethyl-2-[(2R)-oxiran-2-yl]-9-(2-phenylmethoxyethyl)-1,10-dioxaspiro[4.5]decan-3-yl] acetate (PubChem CID 100997760) has the molecular formula C40H52O7Si and a molecular weight of 672.94 g/mol. Its IUPAC name is [(2R,3S,5S,7S,8S,9R)-7-[tert-butyl(diphenyl)silyl]oxy-4,4,8-trimethyl-2-[(2R)-oxiran-2-yl]-9-(2-phenylmethoxyethyl)-1,10-dioxaspiro[4.5]decan-3-yl] acetate.
| Compound Name | [(2R,3S,5S,7S,8S,9R)-7-[tert-butyl(diphenyl)silyl]oxy-4,4,8-trimethyl-2-[(2R)-oxiran-2-yl]-9-(2-phenylmethoxyethyl)-1,10-dioxaspiro[4.5]decan-3-yl] acetate |
|---|---|
| PubChem CID | 100997760 |
| Molecular Formula | C40H52O7Si |
| Molecular Weight | 672.94 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | [(2R,3S,5S,7S,8S,9R)-7-[tert-butyl(diphenyl)silyl]oxy-4,4,8-trimethyl-2-[(2R)-oxiran-2-yl]-9-(2-phenylmethoxyethyl)-1,10-dioxaspiro[4.5]decan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]([C@H]2CO2)O[C@@]2(C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](C)[C@@H](CCOCc3ccccc3)O2)C1(C)C |
| InChI | InChI=1S/C40H52O7Si/c1-28-33(23-24-42-26-30-17-11-8-12-18-30)45-40(39(6,7)37(44-29(2)41)36(46-40)35-27-43-35)25-34(28)47-48(38(3,4)5,31-19-13-9-14-20-31)32-21-15-10-16-22-32/h8-22,28,33-37H,23-27H2,1-7H3/t28-,33+,34-,35+,36-,37+,40-/m0/s1 |
| InChIKey | LDSCWAZRJKYSSW-CIDRBJLWSA-N |
| XLogP | 6.42 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.94 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|