C29H40O5Si — CID 11271928
3-[(2R,3aS,5R,6S,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-6-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanal (PubChem CID 11271928) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is 3-[(2R,3aS,5R,6S,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-6-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanal.
| Compound Name | 3-[(2R,3aS,5R,6S,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-6-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanal |
|---|---|
| PubChem CID | 11271928 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-[(2R,3aS,5R,6S,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-6-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanal |
| SMILES | CO[C@]1(CCC=O)O[C@H]2C[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@H]2C[C@@H]1C |
| InChI | InChI=1S/C29H40O5Si/c1-22-19-26-27(34-29(22,31-5)17-12-18-30)20-23(33-26)21-32-35(28(2,3)4,24-13-8-6-9-14-24)25-15-10-7-11-16-25/h6-11,13-16,18,22-23,26-27H,12,17,19-21H2,1-5H3/t22-,23+,26-,27-,29+/m0/s1 |
| InChIKey | OCXITDFJEDEXAI-HKWSIXNMSA-N |
| XLogP | 4.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|