C21H27NO4Si — CID 10667817
(3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxypyrrolidin-2-one (PubChem CID 10667817) has the molecular formula C21H27NO4Si and a molecular weight of 385.54 g/mol. Its IUPAC name is (3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxypyrrolidin-2-one.
| Compound Name | (3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 10667817 |
| Molecular Formula | C21H27NO4Si |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1NC(=O)[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO4Si/c1-21(2,3)27(15-10-6-4-7-11-15,16-12-8-5-9-13-16)26-14-17-18(23)19(24)20(25)22-17/h4-13,17-19,23-24H,14H2,1-3H3,(H,22,25)/t17-,18-,19+/m1/s1 |
| InChIKey | VRXHJBABHLAKLL-QRVBRYPASA-N |
| XLogP | 0.78 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|