C31H37NO4Si — CID 10940237
ethyl 2-[(2S,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate (PubChem CID 10940237) has the molecular formula C31H37NO4Si and a molecular weight of 515.73 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 10940237 |
| Molecular Formula | C31H37NO4Si |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | ethyl 2-[(2S,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H37NO4Si/c1-5-35-28(33)21-26-27(32-30(34)29(26)23-15-9-6-10-16-23)22-36-37(31(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,26-27,29H,5,21-22H2,1-4H3,(H,32,34)/t26-,27-,29+/m1/s1 |
| InChIKey | KRKBIEVBPISJNL-QQJNOOCOSA-N |
| XLogP | 4.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|