C43H54O5Si — CID 177405589
tert-butyl-[(2S)-2-[(2R,3R,4S,6S,8S)-2-ethyl-4,8-bis(phenylmethoxy)-1,7-dioxaspiro[2.5]octan-6-yl]pentoxy]-diphenylsilane (PubChem CID 177405589) has the molecular formula C43H54O5Si and a molecular weight of 678.99 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(2R,3R,4S,6S,8S)-2-ethyl-4,8-bis(phenylmethoxy)-1,7-dioxaspiro[2.5]octan-6-yl]pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(2R,3R,4S,6S,8S)-2-ethyl-4,8-bis(phenylmethoxy)-1,7-dioxaspiro[2.5]octan-6-yl]pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 177405589 |
| Molecular Formula | C43H54O5Si |
| Molecular Weight | 678.99 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | tert-butyl-[(2S)-2-[(2R,3R,4S,6S,8S)-2-ethyl-4,8-bis(phenylmethoxy)-1,7-dioxaspiro[2.5]octan-6-yl]pentoxy]-diphenylsilane |
| SMILES | CCC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1C[C@H](OCc2ccccc2)[C@@]2(O[C@@H]2CC)[C@@H](OCc2ccccc2)O1 |
| InChI | InChI=1S/C43H54O5Si/c1-6-20-35(32-46-49(42(3,4)5,36-25-16-10-17-26-36)37-27-18-11-19-28-37)38-29-40(44-30-33-21-12-8-13-22-33)43(39(7-2)48-43)41(47-38)45-31-34-23-14-9-15-24-34/h8-19,21-28,35,38-41H,6-7,20,29-32H2,1-5H3/t35-,38-,39+,40-,41-,43+/m0/s1 |
| InChIKey | WEDHJMPWNKPRDX-KYUOHNNBSA-N |
| XLogP | 8.44 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.99 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|