C26H31NO2Si — CID 10549907
tert-butyl-[(1S)-1-(2,4-dihydro-1H-3,1-benzoxazin-2-yl)ethoxy]-diphenylsilane (PubChem CID 10549907) has the molecular formula C26H31NO2Si and a molecular weight of 417.63 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-(2,4-dihydro-1H-3,1-benzoxazin-2-yl)ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1S)-1-(2,4-dihydro-1H-3,1-benzoxazin-2-yl)ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10549907 |
| Molecular Formula | C26H31NO2Si |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | tert-butyl-[(1S)-1-(2,4-dihydro-1H-3,1-benzoxazin-2-yl)ethoxy]-diphenylsilane |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1Nc2ccccc2CO1 |
| InChI | InChI=1S/C26H31NO2Si/c1-20(25-27-24-18-12-11-13-21(24)19-28-25)29-30(26(2,3)4,22-14-7-5-8-15-22)23-16-9-6-10-17-23/h5-18,20,25,27H,19H2,1-4H3/t20-,25?/m0/s1 |
| InChIKey | ZWPDZJWGYSGNOD-JINQPTGOSA-N |
| XLogP | 4.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|