C14H17NO — CID 146244066
2-amino-1-cyclohexa-2,4-dien-1-yl-2-phenylethanol (PubChem CID 146244066) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-amino-1-cyclohexa-2,4-dien-1-yl-2-phenylethanol.
| Compound Name | 2-amino-1-cyclohexa-2,4-dien-1-yl-2-phenylethanol |
|---|---|
| PubChem CID | 146244066 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-amino-1-cyclohexa-2,4-dien-1-yl-2-phenylethanol |
| SMILES | NC(c1ccccc1)C(O)C1C=CC=CC1 |
| InChI | InChI=1S/C14H17NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-9,12-14,16H,10,15H2 |
| InChIKey | ZVDDXKZTCNRPKH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |